public final class Stereocenters extends Object
P(O)(=O)(OC)OCCC. Phosphines and
arsines are always stereogenic regardless of H neighbors
Double Bond Stereochemistry:
The following atoms can appear at either end of a double bond.
O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O
myo-inositolC1CC[C@H]2CCCC[C@H]2C1 (not currently identified)InChI=1/C14H24/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14/h11-12H,3-10H2,1-2H3/b14-13-/t11-,12-
(not currently identified)C[C@@H](O)[C@H](C)[C@H](C)O (not currently identified)C[C@@H](O)[C@H:1](C)[C@H](C)O removes the central
configuration as the ligands are now equivalent C[C@@H](O)[CH:1]](C)[C@@H](C)O| Modifier and Type | Class and Description |
|---|---|
static class |
Stereocenters.Stereocenter
Defines the type of a stereocenter.
|
static class |
Stereocenters.Type |
| Modifier and Type | Method and Description |
|---|---|
Stereocenters.Type |
elementType(int v)
Obtain the type of stereo element support for atom at index
v. |
boolean |
isStereocenter(int v)
Is the atom be a stereocenter (i.e.
|
static Stereocenters |
of(IAtomContainer container)
Determine the stereocenter atoms in the provided container based on
connectivity.
|
Stereocenters.Stereocenter |
stereocenterType(int v)
Determine the type of stereocenter is the atom at index
v. |
public static Stereocenters of(IAtomContainer container)
IAtomContainer container = ...; Stereocenters centers = Stereocenters.of(container); for (int i = 0; i < container.getAtomCount(); i++) { if (centers.isStereocenter(i)) { } }
container - input containerpublic Stereocenters.Type elementType(int v)
v.
Supported elements types are:
Stereocenters.Type.Bicoordinate - an central atom involved in a
cumulated system (not yet supported)Stereocenters.Type.Tricoordinate
- an atom at one end of a geometric (double-bond) stereo bond or
cumulated system.Stereocenters.Type.Tetracoordinate - a tetrahedral
atom (could also be square planar in future)Stereocenters.Type.None -
the atom is not a (supported) stereo element type.v - atom index (vertex)public boolean isStereocenter(int v)
v - atom index (vertex)v is a stereocenterpublic Stereocenters.Stereocenter stereocenterType(int v)
v.
Stereocenters.Stereocenter.True - the atom has constitutionally
different neighborsStereocenters.Stereocenter.Para - the atom
resembles a stereo centre but has constitutionally equivalent neighbors
(e.g. inositol, decalin). The stereocenter depends on the configuration
of one or more stereocenters.Stereocenters.Stereocenter.Potential -
the atom can supported stereo chemistry but has not be shown to be a true
or para center.Stereocenters.Stereocenter.Non - the atom is not a
stereocenter (e.g. methane).v - atom index.Copyright © 2021. All rights reserved.